Sfingozyna

Z Wikipedii, wolnej encyklopedii
Przejdź do nawigacji Przejdź do wyszukiwania
Sfingozyna
Sphingosine structure.svg
Skrócony wzór sfingozyny
Skrócony wzór sfingozyny
Ogólne informacje
Wzór sumaryczny C18H37NO2
Inne wzory CH3-(CH2)12-CH=CHCH(OH)CH(NH2)CH2-OH
Masa molowa 299,5 g/mol
Identyfikacja
Numer CAS 123-78-4
PubChem 5280335[1]
Jeżeli nie podano inaczej, dane dotyczą
stanu standardowego (25 °C, 1000 hPa)

Sfingozyna (CH3(CH2)12CH=CHCH(OH)CH(NH2)CH2OH, C18H37NO2) - organiczny związek chemiczny, osiemnastowęglowy, nienasycony aminoalkohol z jednym wiązaniem podwójnym. Pochodne sfingozyny - sfingolipidy - są składnikami błon komórkowych. Składnik lipidów złożonych takich jak glikosfingolipidy oraz fosfosfingolipidy.

Przypisy[edytuj | edytuj kod]