Celobioza: Różnice pomiędzy wersjami

Przejdź do nawigacji Przejdź do wyszukiwania
Dodane 415 bajtów ,  10 lat temu
m
regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK
m (Usunięcie odwołania do pliku Cellobiose_molecule_structure.png, ponieważ użytkownik ZooFari skasował go z Commons)
m (regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK)
{{Związek chemiczny infobox
| Nazwanazwa = Celobioza
|1. grafika1 grafika = Cellobiose skeletal.png
|opis grafika1_opis 1. grafiki =
|2. grafika2grafika = =
|opis grafika2_opis 2. grafiki =
|3. grafika3 grafika =
|opis grafika3_opis 3. grafiki =
| Nazwanazwa systematyczna = (2''R'',3''S'',4''S'',5''R'',6''S'')-2-(hydroksymetylo)-6-[(2''R'',3''S'',4''R'',5''R'',6''R'')-4,5,6-trihydroksy-2-(hydroksymetylo)oksan-3-ylo]oksyoksano-3,4,5-triol
| Inneinne nazwy = 4-''O''-β-<small>D</small>-glukopiranozylo-<small>D</small>-glukoza
| Wzórwzór sumaryczny = C<sub>12</sub>H<sub>22</sub>O<sub>11</sub>
| Inneinne wzory =
| Masamasa molowa = 342,30
| SMILES = C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O
| Wyglądwygląd = białe [[ciało krystaliczne]] w postaci igieł<ref name=psc>{{cytuj książkę |autor=Romuald Hassa |autor2=Janusz Mrzigod |autor3=Janusz Nowakowski |tytuł=Podręczny słownik chemiczny |wydanie=I |wydawca=[[Videograf II]] |miejsce=Katowice |rok=2002 |isbn=83-71-83-240-0}}</ref>
| Masa molowa = 342,30
| SMILES = C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O
| Wygląd = białe [[ciało krystaliczne]] w postaci igieł<ref name=psc>{{cytuj książkę |autor=Romuald Hassa |autor2=Janusz Mrzigod |autor3=Janusz Nowakowski |tytuł=Podręczny słownik chemiczny |wydanie=I |wydawca=[[Videograf II]] |miejsce=Katowice |rok=2002 |isbn=83-71-83-240-0}}</ref>
| Numernumer CAS = 528-50-7
| PubChem = {{PubChem|10712}}
| DrugBank =
|gęstość Właściwości = ukryj
|gęstość Gęstośćźródło = =
| Stanstan skupienia w podanej Gg =
| Gg warunki niestandardowe =
| Rozpuszczalnośćrozpuszczalność w wodzie = rozpuszczalny<ref name=psc/>
| RwWrww warunki niestandardowe =
| Inneinne rozpuszczalniki = słabo w [[alkohol etylowy|etanolu]]<ref name=psc/>
| Temperaturatemperatura topnienia = 239
|tt minerałźródło = =
| Tttt warunki niestandardowe = <ref name=Sigma>{{Sigma-Aldrich|22150|FLUKA|data dostępu=2011-01-07}}</ref>
| Temperaturatemperatura wrzenia =
| Tw warunki niestandardowe =
|tw źródło Temperatura krytyczna =
| Twtw warunki niestandardowe =
| Ciśnienie krytyczne =
|temperatura Kwasowośćkrytyczna = =
|tk źródło Zasadowość =
|ciśnienie Aktywnośćkrytyczne optyczna = =
|ck Lepkośćźródło = =
|kwasowość Reaktywność = 0
| L warunki niestandardowe =
|zasadowość =
| Napięcie powierzchniowe =
|aktywność optyczna =
| Np warunki niestandardowe =
|lepkość Punkt izoelektryczny =
|l Typwarunki hybrydyzacjiniestandardowe i VSEPR = =
| Napięcienapięcie powierzchniowe =
| Układ krystalograficzny =
| Lnp warunki niestandardowe = =
| Moment dipolowy =
|punkt izoelektryczny =
| Zewnętrzne dane MSDS = http://www.sciencelab.com/msds.php?msdsId=9927488
|typ hybrydyzacji i VSEPR =
| Źródło zagrożeń = &nbsp;wg MSDS
| Układukład krystalograficzny =
| Piktogram = {{Piktogram ostrzegawczy|brak}}
|moment Palność dipolowy = 1
|moment Zdrowie dipolowy źródło = 1
| Zewnętrznezewnętrzne dane MSDS = http://www.sciencelab.com/msds.php?msdsId=9927488
| Reaktywność = 0
|zagrożenia InneGHS źródło = =
|piktogram GHS Temperatura zapłonu =
|hasło GHS =
| Tz warunki niestandardowe =
|zwroty H =
| Temperatura samozapłonu =
|zwroty EUH =
| Ts warunki niestandardowe =
|zwroty ZwrotyP ryzyka = {{Zwroty R|brak}} =
|zagrożenia UE źródło = &nbsp;wg MSDS
| Zwroty bezpieczeństwa = {{Zwroty S|brak}}
|piktogram NumerUE RTECS = {{Piktogram =ostrzegawczy|brak}}
|zwroty R Inne aniony = {{Zwroty R|brak}}
|zwroty S Inne kationy = {{Zwroty S|brak}}
|NFPA Pochodne704 ? = {{NFPA 704|zdrowie=1|palność=1|reaktywność=0|inne=}}
|NFPA ?704 źródło = =
|temperatura Podobnezapłonu związki = =
|tz aktywnyźródło = =
| Nptz warunki niestandardowe =
| minerał =
| Temperaturatemperatura samozapłonu =
|ts źródło =
| Tzts warunki niestandardowe =
|numer RTECS =
|dawka śmiertelna =
|inne aniony =
|inne kationy =
|pochodne ? =
|? =
|podobne związki =
|commons =
}}
'''Celobioza''' – [[związek organiczny|organiczny]] [[związek chemiczny]], [[disacharydy|dwucukier]], [[dimery|dimer]] [[glukoza|glukozy]], zbudowany z dwóch [[cząsteczka|cząsteczek]] glukozy, połączonych [[wiązanie glikozydowe|wiązaniem β-1,4-glikozydowym]]. Jest jednostką strukturalną [[celuloza|celulozy]] i produktem jej częściowej [[hydroliza|hydrolizy]]<ref name=psc/><ref>{{cytuj książkę |tytuł=Encyklopedia popularna, Tom I |wydanie=II |wydawca=[[Wydawnictwo Naukowe PWN|PWN]] |miejsce=Warszawa |rok=1983 |isbn=83-01-00000-7}}</ref>.
3 437 414

edycji

Menu nawigacyjne