Fluoresceina: Różnice pomiędzy wersjami

Przejdź do nawigacji Przejdź do wyszukiwania
Usunięte 11 bajtów ,  6 lat temu
m
infobox, źródła/przypisy
(drobne techniczne)
m (infobox, źródła/przypisy)
|inne wzory =
|masa molowa = 332,31
|wygląd = pomarańczowoczerwony, miałki proszek<ref name="FP8FPX">{{cytuj książkę|nazwisko=Polskie Towarzystwo Farmaceutyczne |tytuł=Farmakopea Polska VIIIX|rok=20082014 |wydawca=Urząd Rejestracji Produktów Leczniczych, Wyrobów Medycznych i Produktów Biobójczych |miejsce=Warszawa |isbn=978-838815783-63724-5347-07 |strony=34914276}}</ref>
|SMILES = C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
|numer CAS = {{CAS|2321-07-5|rok=2015}}<br />518-47-8 (sól disodowa)<br />13182-27-9 (sól monosodowa)<br />6417-85-2 (sól dipotasowa)
|g warunki niestandardowe =
|rozpuszczalność w wodzie = praktycznie nierozpuszczalna
|rww źródło = {{r|FP8FPX|AKRON}}
|rww warunki niestandardowe =
|inne rozpuszczalniki = '''ciepły [[etanol]]''': rozpuszczalna{{r|FP8FPX}}
|temperatura topnienia = 314–320
|tt źródło = {{r|FP8FPX|DrugBank}}<ref>{{ChemIDplus|2321-07-5|data dostępu=2012-08-21}}</ref><ref name="AKRON">{{Akron|10000/8418|data dostępu=2012-08-21}}</ref><ref name="SA">{{Sigma-Aldrich|MSDS=tak|id= F2456|marka= Aldrich}}</ref>
|tt warunki niestandardowe =
|temperatura wrzenia =

Menu nawigacyjne