Pentazocyna: Różnice pomiędzy wersjami

Przejdź do nawigacji Przejdź do wyszukiwania
Usunięte 473 bajty ,  7 lat temu
Przekształcanie szablonu Szablon:Związek chemiczny infobox
[wersja przejrzana][wersja przejrzana]
m (aktualizacja wywołania szablonu CAS)
(Przekształcanie szablonu Szablon:Związek chemiczny infobox)
|nazwa = Pentazocyna
|1. grafika = Pentazocine Enantiomers Structural Formulae V.2.svg
|opis 1. grafiki =
|2. grafika =
|opis 2. grafiki =
|3. grafika =
|opis 3. grafiki =
|nazwa systematyczna =
|inne nazwy =
|wzór sumaryczny = C<sub>19</sub>H<sub>27</sub>NO
|inne wzory =
|masa molowa = 285,42
|wygląd =
|SMILES = C[C@H]1[C@H]2CC3=C([C@@]1(CCN2CC=C(C)C)C)C=C(C=C3)O
|numer CAS = {{CAS|359-83-1|rok=2013}}
|PubChem = {{PubChem|441278}}
|DrugBank = APRD01173
|gęstość =
|gęstość źródło =
|stan skupienia w podanej g =
|g warunki niestandardowe =
|rozpuszczalność w wodzie =
|NFPA 704rww źródło =
|rww warunki niestandardowe =
|inne rozpuszczalniki =
|temperaturainne rozpuszczalniki topnienia =
|tttemperatura źródłotopnienia = =
|receptorytt źródło =
|tt warunki niestandardowe =
|temperatura wrzenia =
|twtemperatura źródłowrzenia = =
|transporttw źródło =
|tw warunki niestandardowe =
|temperatura krytyczna =
|tktemperatura źródłokrytyczna = =
|ciśnienietk źródło krytyczne =
|ckciśnienie źródłokrytyczne = =
|kwasowośćck źródło =
|zasadowośćlogP =
|aktywnośćkwasowość optyczna =
|lepkośćzasadowość = =
|funkcjelepkość =
|l warunki niestandardowe =
|typl genuźródło =
|napięcie powierzchniowe =
|npl warunki niestandardowe =
|punktnapięcie izoelektrycznypowierzchniowe = =
|pochodnenp źródło ? =
|typ hybrydyzacji i VSEPR =
|lnp warunki niestandardowe =
|układ krystalograficzny =
|moment dipolowy =
|moment dipolowy źródło =
|zewnętrznemoment danedipolowy MSDSźródło = =
|zagrożeniakarta GHS źródłocharakterystyki =
|piktogramzagrożenia GHS źródło = =
|hasłopiktogram GHS = =
|zwroty Hhasło GHS =
|zwroty EUHH =
|zwroty PEUH = =
|zagrożeniazwroty P UE źródło =
|piktogramNFPA 704 UE =
|zwrotyNFPA R704 źródło = =
|zwrotytemperatura Szapłonu = =
|NFPA 704tz źródło =
|tstz warunki niestandardowe =
|NFPA 704 źródło =
|temperatura zapłonusamozapłonu = =
|tzts źródło =
|tzts warunki niestandardowe =
|momentnumer RTECS dipolowy =
|temperatura samozapłonu =
|tsdawka źródłośmiertelna = =
|choroby pochodne =
|ts warunki niestandardowe =
|numerpodobne RTECSzwiązki = =
|dawkaATC śmiertelna =
|inne aniony =
|inne kationy =
|pochodne ? =
|? =
|podobne związki =
|ATC =
|EC =
|legalność w Polsce = II-P
|stosowanie w ciąży = C/D
|działanie =
|procent wchłaniania =
|biodostępność = ~20%
|okres półtrwania = 2-3 h
|wiązanie z białkami osocza =
|metabolizm = [[Wątroba]]
|wydalanie =
|locus =
|typ genu =
|typ białka =
|receptory =
|wydzielanie =
|transport =
|funkcje =
|antagoniści =
|choroby =
|drogi podawania = doustnie
|objętość dystrybucji =
|stężenie terapeutyczne =
|objętośćcommons dystrybucji =
|commons =
'''Pentazocyna''' – [[związek organiczny|organiczny związek chemiczny]], [[opioid]]owy [[lek przeciwbólowy]], pochodna [[benzomorfan]]u, stosowana w bólach o nasileniu umiarkowanym. Wykazuje działanie słabsze i krótsze od [[morfina|morfiny]]. W Polsce występuje pod nazwami handlowymi ''Fortral'' (tabletki) i ''Pentazocinum'' (roztwór do wstrzykiwań dożylnych, domięśniowych i podskórnych).
1 294 272


Menu nawigacyjne